Ethyl Azidoacetate
- Product NameEthyl Azidoacetate
- CAS637-81-0
- CBNumberCB7334391
- MFC4H7N3O2
- MW129.12
- EINECS211-301-3
- MDL NumberMFCD00190177
- MOL File637-81-0.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 44-46°C 2mm |
| Density | 1.12g/ml |
| refractive index | 1.4330 to 1.4370 |
| Flash point | 25 °C |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| BRN | 4247209 |
| InChI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CN=[N+]=[N-] |
| CAS DataBase Reference | 637-81-0(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H336-H351 | |||||||||
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | Xn,Xi,C,F | |||||||||
| Risk Statements | 1-40-36/37/38-10-67-65-63-48/20-38-11 | |||||||||
| Safety Statements | 7-16-26-35-36-47-62-45-36/37 | |||||||||
| RIDADR | UN 1593 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Irritant/Corrosive | |||||||||
| HS Code | 2929.90.5090 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 | |||||||||
| NFPA 704: |
|
