Ethyl Azidoacetate
- Product NameEthyl Azidoacetate
- CAS637-81-0
- MFC4H7N3O2
- MW129.12
- EINECS211-301-3
- MOL File637-81-0.mol
Chemical Properties
| Boiling point | 44-46°C 2mm |
| Density | 1.12g/ml |
| refractive index | 1.4330 to 1.4370 |
| Flash point | 25 °C |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| BRN | 4247209 |
| InChI | InChI=1S/C4H7N3O2/c1-2-9-4(8)3-6-7-5/h2-3H2,1H3 |
| InChIKey | HVJJYOAPXBPQQV-UHFFFAOYSA-N |
| SMILES | C(=O)(OCC)CN=[N+]=[N-] |
| CAS DataBase Reference | 637-81-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 1-40-36/37/38-10-67-65-63-48/20-38-11 |
| Safety Statements | 7-16-26-35-36-47-62-45-36/37 |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Corrosive |
| HS Code | 2929.90.5090 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 |
