Tetrakis(dimethylamino)zirconium
- Product NameTetrakis(dimethylamino)zirconium
- CAS19756-04-8
- CBNumberCB7283264
- MFC8H24N4Zr
- MW267.53
- EINECS629-068-5
- MDL NumberMFCD00239502
- MOL File19756-04-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 57-60 °C(lit.) |
| Boiling point | 80°C 0,1mm |
| Flash point | >65℃ |
| storage temp. | 2-8°C |
| form | solid |
| Sensitive | moisture sensitive, store cold |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/4C2H6N.Zr/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | DWCMDRNGBIZOQL-UHFFFAOYSA-N |
| SMILES | [Zr](N(C)C)(N(C)C)(N(C)C)N(C)C |
| UNSPSC Code | 12352300 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H228-H261-H315-H319-H335 |
| Precautionary statements | P210-P231+P232-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-14/15-36/37/38 |
| Safety Statements | 16-26-36-43 |
| RIDADR | UN 3396 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.3, 4.1 |
| HS Code | 29310099 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 Water-react 2 |
