Tetrakis(dimethylamido)hafnium(IV)
- Product NameTetrakis(dimethylamido)hafnium(IV)
- CAS19782-68-4
- CBNumberCB0501512
- MFC8H24HfN4
- MW354.79
- MDL NumberMFCD01862473
- MOL File19782-68-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 26-29 °C(lit.) |
| Boiling point | 85°C/0.1mm |
| Density | 1.098 g/mL at 25 °C |
| Flash point | 109 °F |
| form | crystal |
| color | colorless to pale yellow |
| Specific Gravity | 1.40 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive, store cold |
| InChI | InChI=1S/4C2H6N.Hf/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | ZYLGGWPMIDHSEZ-UHFFFAOYSA-N |
| SMILES | [Hf](N(C)C)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 19782-68-4 |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H228-H261-H314 |
| Precautionary statements | P210-P231+P232-P280-P305+P351+P338-P370+P378-P402+P404 |
| Hazard Codes | F,C |
| Risk Statements | 11-14-34 |
| Safety Statements | 6-26-36/37/39-43-45 |
| RIDADR | UN 3396 4.3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 4.3, 4.1 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B Water-react 2 |
