19756-04-8
| Name | TETRAKIS(DIMETHYLAMINO)ZIRCONIUM |
| CAS | 19756-04-8 |
| EINECS(EC#) | 243-271-2 |
| Molecular Formula | C8H24N4Zr |
| MDL Number | MFCD00239502 |
| Molecular Weight | 267.53 |
| MOL File | 19756-04-8.mol |
Chemical Properties
| Appearance | Pale yellow-greenish crystalline solid |
| Melting point | 57-60 °C(lit.) |
| Boiling point | 80°C 0,1mm |
| Fp | >65℃ |
| storage temp. | water-free area |
| form | solid |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | moisture sensitive, store cold |
| InChI | InChI=1S/4C2H6N.Zr/c4*1-3-2;/h4*1-2H3;/q4*-1;+4 |
| InChIKey | DWCMDRNGBIZOQL-UHFFFAOYSA-N |
| SMILES | [Zr](N(C)C)(N(C)C)(N(C)C)N(C)C |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H261-H315-H319-H335 |
| Precautionary statements | P210-P231+P232-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3396 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.3, 4.1 |
| HS Code | 29310099 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 Water-react 2 |