175923-04-3
| Name | TETRAKIS(ETHYLMETHYLAMINO)ZIRCONIUM |
| CAS | 175923-04-3 |
| Molecular Formula | C12H32N4Zr |
| MDL Number | MFCD03427131 |
| Molecular Weight | 323.63 |
| MOL File | 175923-04-3.mol |
Chemical Properties
| Boiling point | 81 °C0.1 mm Hg(lit.) |
| density | 1.049 g/mL at 25 °C(lit.) |
| Fp | 50 °F |
| form | liquid |
| color | light yellow |
| Specific Gravity | 1.049 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/4C3H8N.Zr/c4*1-3-4-2;/h4*3H2,1-2H3;/q4*-1;+4 |
| InChIKey | SRLSISLWUNZOOB-UHFFFAOYSA-N |
| SMILES | [Zr](N(C)CC)(N(C)CC)(N(C)CC)N(C)CC |
Safety Data
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3398 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.3 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 Water-react 2 |