2,4,4'-Trihydroxybenzophenone
- Product Name2,4,4'-Trihydroxybenzophenone
- CAS1470-79-7
- CBNumberCB6493112
- MFC13H10O4
- MW230.22
- EINECS216-004-2
- MDL NumberMFCD00002356
- MOL File1470-79-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 197-198 °C(lit.) |
| Boiling point | 332.2°C (rough estimate) |
| Density | 1.2683 (rough estimate) |
| refractive index | 1.4977 (estimate) |
| storage temp. | RT, stored under nitrogen |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | 7.59±0.35(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | 1S/C13H10O4/c14-9-3-1-8(2-4-9)13(17)11-6-5-10(15)7-12(11)16/h1-7,14-16H |
| InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1)C(=O)c2ccc(O)cc2O |
| CAS DataBase Reference | 1470-79-7(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | QP9121IG2S |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2914.50.3000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
