1,1-Dichlorosilacyclobutane
- Product Name1,1-Dichlorosilacyclobutane
- CAS2351-33-9
- CBNumberCB6465672
- MFC3H6Cl2Si
- MW141.07
- EINECS219-084-7
- MDL NumberMFCD00053537
- MOL File2351-33-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | <0°C |
| Boiling point | 115 °C |
| Density | 1.20 |
| refractive index | 1.46 |
| Flash point | 20 °C |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.201 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/C3H6Cl2Si/c4-6(5)2-1-3-6/h1-3H2 |
| InChIKey | PASYEMKYRSIVTP-UHFFFAOYSA-N |
| SMILES | [Si]1(Cl)(Cl)CCC1 |
| FDA UNII | 439Q7T3Y9G |
| EPA Substance Registry System | Silacyclobutane, 1,1-dichloro- (2351-33-9) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H260-H314 | |||||||||
| Precautionary statements | P210-P223-P231+P232-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 14-34 | |||||||||
| Safety Statements | 16-23-26-36/37/39-45 | |||||||||
| RIDADR | UN 2988 4.3/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B Water-react 1 | |||||||||
| NFPA 704: |
|
