2351-33-9
| Name | 1,1-DICHLOROSILACYCLOBUTANE |
| CAS | 2351-33-9 |
| EINECS(EC#) | 219-084-7 |
| Molecular Formula | C3H6Cl2Si |
| MDL Number | MFCD00053537 |
| Molecular Weight | 141.07 |
| MOL File | 2351-33-9.mol |
Chemical Properties
| Appearance | clear colorless to slightly yellow liquid |
| Melting point | <0°C |
| Boiling point | 113-115 °C(lit.) |
| density | 1.19 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 68 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.201 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/C3H6Cl2Si/c4-6(5)2-1-3-6/h1-3H2 |
| InChIKey | PASYEMKYRSIVTP-UHFFFAOYSA-N |
| SMILES | [Si]1(Cl)(Cl)CCC1 |
| EPA Substance Registry System | Silacyclobutane, 1,1-dichloro- (2351-33-9) |
Safety Data
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H260-H314 |
| Precautionary statements | P210-P223-P231+P232-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2988 4.3/PG 1 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29349990 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B Water-react 1 |