1,1-DICHLOROSILACYCLOBUTANE
- Product Name1,1-DICHLOROSILACYCLOBUTANE
- CAS2351-33-9
- MFC3H6Cl2Si
- MW141.07
- EINECS219-084-7
- MOL File2351-33-9.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 113-115 °C (lit.) |
| Density | 1.19 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 68 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| Specific Gravity | 1.201 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | InChI=1S/C3H6Cl2Si/c4-6(5)2-1-3-6/h1-3H2 |
| InChIKey | PASYEMKYRSIVTP-UHFFFAOYSA-N |
| SMILES | [Si]1(Cl)(Cl)CCC1 |
| EPA Substance Registry System | Silacyclobutane, 1,1-dichloro- (2351-33-9) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 16-23-26-36/37/39-45 |
| RIDADR | UN 2988 4.3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B Water-react 1 |