5-Bromo-2-methyl-2-pentene
- Product Name5-Bromo-2-methyl-2-pentene
- CAS2270-59-9
- CBNumberCB6462772
- MFC6H11Br
- MW163.06
- EINECS627-445-9
- MDL NumberMFCD00009887
- MOL File2270-59-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -102.35°C (estimate) |
| Boiling point | 152-154 °C (lit.) |
| Density | 1.217 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 73 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 1.217 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Slightly miscible with water. |
| BRN | 1735749 |
| InChI | InChI=1S/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
| InChIKey | UNXURIHDFUQNOC-UHFFFAOYSA-N |
| SMILES | C/C(/C)=C\CCBr |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-23 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29033990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
