
2270-59-9
| Name | 5-BROMO-2-METHYL-2-PENTENE |
| CAS | 2270-59-9 |
| EINECS(EC#) | 627-445-9 |
| Molecular Formula | C6H11Br |
| MDL Number | MFCD00009887 |
| Molecular Weight | 163.06 |
| MOL File | 2270-59-9.mol |
Chemical Properties
| Melting point | -102.35°C (estimate) |
| Boiling point | 152-154 °C(lit.) |
| density | 1.217 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 73 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 1.217 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Slightly miscible with water. |
| BRN | 1735749 |
| InChI | InChI=1S/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
| InChIKey | UNXURIHDFUQNOC-UHFFFAOYSA-N |
| SMILES | C/C(/C)=C\CCBr |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29033990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |

