4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate
- Product Name4-Thiophenyl phenyl diphenyl sulfonium hexafluoroantimonate
- CAS71449-78-0
- CBNumberCB6236607
- MFC24H19F6S2Sb
- MW607.29
- EINECS680-227-5
- MDL NumberMFCD01940868
- MOL File71449-78-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 118-119 °C |
| Density | 1,4 g/cm3 |
| vapor pressure | 0.002Pa at 25℃ |
| Flash point | 145°C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Sparingly), DMSO (Sparingly) |
| form | Solid |
| Specific Gravity | 1.40 |
| color | White to Off-White |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C24H19S2.6FH.Sb/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;;;;;;;/h1-19H;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | SQPBZCDQRJYQKD-UHFFFAOYSA-H |
| SMILES | [S+](C1=CC=CC=C1)(C1=CC=CC=C1)C1C=CC(SC2=CC=CC=C2)=CC=1.[Sb-](F)(F)(F)(F)(F)F |
| LogP | -0.426 at 20℃ |
| EPA Substance Registry System | Sulfonium, diphenyl[4-(phenylthio)phenyl]-, (OC-6-11)-hexafluoroantimonate(1-) (71449-78-0) |
Safety
| Symbol(GHS) |
 
|
| Signal word | Warning |
| Hazard statements | H317-H302-H410 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P273-P391-P501 |
| Risk Statements | 20/22-51/53 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1549 |
| HazardClass | 8 |
| PackingGroup | III |
