| Melting point |
118-119 °C |
| Density |
1,4 g/cm3 |
| vapor pressure |
0.002Pa at 25℃ |
| Flash point |
145°C |
| storage temp. |
Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility |
Chloroform (Sparingly), DMSO (Sparingly) |
| form |
Solid |
| Specific Gravity |
1.40 |
| color |
White to Off-White |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| InChI |
InChI=1S/C24H19S2.6FH.Sb/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;;;;;;;/h1-19H;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey |
SQPBZCDQRJYQKD-UHFFFAOYSA-H |
| SMILES |
[S+](C1=CC=CC=C1)(C1=CC=CC=C1)C1C=CC(SC2=CC=CC=C2)=CC=1.[Sb-](F)(F)(F)(F)(F)F |
| LogP |
-0.426 at 20℃ |
| EPA Substance Registry System |
Sulfonium, diphenyl[4-(phenylthio)phenyl]-, (OC-6-11)-hexafluoroantimonate(1-) (71449-78-0) |
