DibroMoethane-d4
- Product NameDibroMoethane-d4
- CAS22581-63-1
- CBNumberCB6149152
- MFC2Br2D4
- MW191.89
- EINECS245-102-8
- MDL NumberMFCD00037499
- MOL File22581-63-1.mol
Chemical Properties
| Melting point | 9°C |
| Boiling point | 131-132 °C(lit.) |
| Density | 2.226 g/mL at 25 °C |
| refractive index | n |
| Flash point | 132°C |
| storage temp. | Refrigerator |
| solubility | Acetonitrile, Chloroform |
| form | Liquid |
| color | Colourless to Yellow |
| Water Solubility | Insoluble in water. Soluble in chloroform. |
| Henry's Law Constant | 1.6×10-2 mol/(m3Pa) at 25℃, Hiatt (2013) |
| Stability | Volatile |
| Major Application | agriculture environmental pharmaceutical |
| InChI | InChI=1S/C2H4Br2/c3-1-2-4/h1-2H2/i1D2,2D2 |
| InChIKey | PAAZPARNPHGIKF-LNLMKGTHSA-N |
| SMILES | C([2H])([2H])(Br)C([2H])([2H])Br |
| UNSPSC Code | 12142201 |
| NACRES | NA.21 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311-H315-H319-H330-H335-H350 | |||||||||
| Precautionary statements | P201-P280-P301+P310+P330-P302+P352+P312-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 45-23/24/25-36/37/38-51/53 | |||||||||
| Safety Statements | 53-45 | |||||||||
| RIDADR | UN 1605 6.1/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | I | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Carc. 1B Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
