DibroMoethane-d4
- Product NameDibroMoethane-d4
- CAS22581-63-1
- MFC2Br2D4
- MW191.89
- EINECS245-102-8
- MOL File22581-63-1.mol
Chemical Properties
| Melting point | 9°C |
| Boiling point | 131-132 °C(lit.) |
| Density | 2.226 g/mL at 25 °C |
| refractive index | n |
| Flash point | 132°C |
| storage temp. | Refrigerator |
| solubility | Acetonitrile, Chloroform |
| form | Liquid |
| color | Colourless to Yellow |
| Water Solubility | Insoluble in water. Soluble in chloroform. |
| Henry's Law Constant | 1.6×10-2 mol/(m3Pa) at 25℃, Hiatt (2013) |
| Stability | Volatile |
| Major Application | agriculture environmental pharmaceutical |
| InChI | InChI=1S/C2H4Br2/c3-1-2-4/h1-2H2/i1D2,2D2 |
| InChIKey | PAAZPARNPHGIKF-LNLMKGTHSA-N |
| SMILES | C([2H])([2H])(Br)C([2H])([2H])Br |
| CAS Number Unlabeled | 106-93-4 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-23/24/25-36/37/38-51/53 |
| Safety Statements | 53-45 |
| RIDADR | UN 1605 6.1/PG 1 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | I |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Carc. 1B Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
