5-(Aminomethyl)-2-chloropyridine
- Product Name5-(Aminomethyl)-2-chloropyridine
- CAS97004-04-1
- CBNumberCB5214246
- MFC6H7ClN2
- MW142.59
- EINECS619-497-6
- MDL NumberMFCD00673153
- MOL File97004-04-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 28-34 °C |
| Boiling point | 101-102°C 1mm |
| Density | 1.244±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil to Low-Melting Solid |
| pka | 7.78±0.29(Predicted) |
| color | Off-White to Light Brown |
| Sensitive | Hygroscopic |
| BRN | 8308740 |
| Stability | Hygroscopic |
| InChI | InChI=1S/C6H7ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H,3,8H2 |
| InChIKey | XPARFBOWIYMLMY-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1CN |
| CAS DataBase Reference | 97004-04-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H317-H318-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T,C | |||||||||
| Risk Statements | 25-37/38-41-43-34 | |||||||||
| Safety Statements | 26-36/37/39-45-20 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933399990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 | |||||||||
| NFPA 704: |
|
![1,3,5-Triazine, 1,3,5-tris[(6-chloro-3-pyridinyl)methyl]hexahydro-](/CAS/20210305/GIF/1080018-12-7.gif)
