2-chloro-5-cyanopyridine
- Product Name2-chloro-5-cyanopyridine
- CAS33252-28-7
- CBNumberCB4366126
- MFC6H3ClN2
- MW138.55
- EINECS608-851-5
- MDL NumberMFCD00084941
- MOL File33252-28-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 116-120 °C(lit.) |
| Boiling point | 105-107°C 1mm |
| Density | 1.33±0.1 g/cm3(Predicted) |
| Flash point | 105-107°C/1mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Ethanol |
| pka | -3.56±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 113867 |
| InChI | InChI=1S/C6H3ClN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H |
| InChIKey | ORIQLMBUPMABDV-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC=C1C#N |
| CAS DataBase Reference | 33252-28-7(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,T,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36-36/37/39-37 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
