(1S,2S)-(+)-2-Benzyloxycyclopentylamine
- Product Name(1S,2S)-(+)-2-Benzyloxycyclopentylamine
- CAS181657-57-8
- CBNumberCB4746797
- MFC12H17NO
- MW191.27
- EINECS623-933-0
- MDL NumberMFCD01075751
- MOL File181657-57-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 23℃ |
| alpha | 73 º (C=1 IN CHLOROFORM) |
| Boiling point | 90-93°C 0,2mm |
| Density | 0.983 |
| refractive index | 1.5305 |
| Flash point | >110°C |
| storage temp. | 2-8°C |
| pka | 10.11±0.40(Predicted) |
| form | liquid |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| BRN | 9554058 |
| InChI | 1S/C12H17NO/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,13H2/t11-,12-/m0/s1 |
| InChIKey | JIMSXLUBRRQALI-RYUDHWBXSA-N |
| SMILES | N[C@H]1CCC[C@@H]1OCc2ccccc2 |
| UNSPSC Code | 12352112 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311-H314 | |||||||||
| Precautionary statements | P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P361+P364 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-21/22 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | 2735 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 | |||||||||
| NFPA 704: |
|