4-Vinylcyclohexene dioxide
- Product Name4-Vinylcyclohexene dioxide
- CAS106-87-6
- CBNumberCB4213606
- MFC8H12O2
- MW140.18
- EINECS203-437-7
- MDL NumberMFCD00022354
- MOL File106-87-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -55°C |
| Boiling point | 230-232 °C(lit.) |
| Density | 1.094 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 225 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Colorless or pale yellow liquid |
| color | Colorless to light yellow |
| Water Solubility | 154.7g/L(20 ºC) |
| BRN | 106071 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, alcohols, amines and other compounds containg an active hydrogen. Hydrolyzes slowly in water. |
| InChI | InChI=1S/C8H12O2/c1-2-6-7(10-6)3-5(1)8-4-9-8/h5-8H,1-4H2 |
| InChIKey | OECTYKWYRCHAKR-UHFFFAOYSA-N |
| SMILES | C12C(O1)CCC(C1CO1)C2 |
| Toxicology and Carcinogenesis | Toxicology and Carcinogenesis Studies of 4-Vinyl-1-cyclohexene Diepoxide (CASRN 106-87-6) in F344/N Rats and B6C3F1 Mice (Dermal Studies) |
| CAS DataBase Reference | 106-87-6(CAS DataBase Reference) |
| FDA UNII | 596C064IG4 |
| IARC | 2B (Vol. Sup 7, 60) 1994 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H351 |
| Precautionary statements | P201-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-68/20/21/22-68 |
| Safety Statements | 23-24-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| OEB | A |
| OEL | TWA: 10 ppm (60 mg/m3) [skin] |
| WGK Germany | 1 |
| RTECS | RN8640000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 1B Muta. 2 Repr. 1B |
| Hazardous Substances Data | 106-87-6(Hazardous Substances Data) |

