1-[(4-Methylphenyl)sulfonyl]-1H-imidazole
- Product Name1-[(4-Methylphenyl)sulfonyl]-1H-imidazole
- CAS2232-08-8
- CBNumberCB3414604
- MFC10H10N2O2S
- MW222.26
- EINECS218-771-9
- MDL NumberMFCD00005285
- MOL File2232-08-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 76-78 °C(lit.) |
| Boiling point | 409.1±38.0 °C(Predicted) |
| Density | 1.3038 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | chloroform: soluble25mg/mL, clear, colorless to faintly yellow |
| form | Crystals or Crystalline Powder |
| pka | 1.22±0.10(Predicted) |
| color | White to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 612451 |
| InChI | InChI=1S/C10H10N2O2S/c1-9-2-4-10(5-3-9)15(13,14)12-7-6-11-8-12/h2-8H,1H3 |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | C1N(S(C2=CC=C(C)C=C2)(=O)=O)C=CN=1 |
| CAS DataBase Reference | 2232-08-8(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HS Code | 29332900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

