3,3,3-Trifluoropropylmethyldimethoxysilane
- Product Name3,3,3-Trifluoropropylmethyldimethoxysilane
- CAS358-67-8
- CBNumberCB3230972
- MFC6H13F3O2Si
- MW202.25
- EINECS206-619-4
- MDL NumberMFCD00053175
- MOL File358-67-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 27 °C |
| Boiling point | 85 °C |
| Density | 1.089 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 58°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| Specific Gravity | 1.095 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1753237 |
| InChI | InChI=1S/C6H13F3O2Si/c1-10-5(11-2)12-4-3-6(7,8)9/h5H,3-4,12H2,1-2H3 |
| InChIKey | YEROEIVBCZSQJY-UHFFFAOYSA-N |
| SMILES | [SiH2](C(OC)OC)CCC(F)(F)F |
| CAS DataBase Reference | 358-67-8(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, dimethoxymethyl(3,3,3-trifluoropropyl)- (358-67-8) |
| UNSPSC Code | 12352103 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335-H226 | |||||||||
| Precautionary statements | P261-P280g-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| NFPA 704: |
|
