1H,1H,2H,2H-Perfluorodecyltriethoxysilane
- Product Name1H,1H,2H,2H-Perfluorodecyltriethoxysilane
- CAS101947-16-4
- CBNumberCB3102534
- MFC16H19F17O3Si
- MW610.38
- EINECS-0
- MDL NumberMFCD00042334
- MOL File101947-16-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | < 0 °C |
| Boiling point | 209-230 °C |
| Density | 1.389 g/mL at 25 °C |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with ethanol and tetrahydrofuran. |
| form | liquid |
| Specific Gravity | 1.41 |
| color | Colourless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Cosmetics Ingredients Functions | ANTICAKING |
| InChI | InChI=1S/C16H19F17O3Si/c1-4-34-37(35-5-2,36-6-3)8-7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h4-8H2,1-3H3 |
| InChIKey | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| SMILES | [Si](OCC)(OCC)(OCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 101947-16-4(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H332-H351-H360D-H362-H372 | |||||||||
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 1760 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | No | |||||||||
| HazardClass | 8 | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 | |||||||||
| NFPA 704: |
|
