| Boiling point |
85 °C |
| Density |
1.089 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.358 |
| Flash point |
58°C |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| form |
clear liquid |
| Specific Gravity |
1.095 |
| color |
Colorless to Almost colorless |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| Sensitive |
Moisture Sensitive |
| BRN |
1753237 |
| InChI |
InChI=1S/C6H13F3O2Si/c1-10-5(11-2)12-4-3-6(7,8)9/h5H,3-4,12H2,1-2H3 |
| InChIKey |
YEROEIVBCZSQJY-UHFFFAOYSA-N |
| SMILES |
[SiH2](C(OC)OC)CCC(F)(F)F |
| CAS DataBase Reference |
358-67-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, dimethoxymethyl(3,3,3-trifluoropropyl)- (358-67-8) |
