7-Hydroxyaristolochic acid A
- Product Name7-Hydroxyaristolochic acid A
- CAS79185-75-4
- CBNumberCB31118190
- MFC17H11NO8
- MW357.27
- MDL NumberMFCD03840549
- MOL File79185-75-4.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 663.7±55.0 °C(Predicted) |
| Density | 1.656±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO; |
| pka | 2.94±0.20(Predicted) |
| form | powder |
| color | Light yellow |
| Water Solubility | sparingly soluble in water |
| Major Application | food and beverages |
| InChI | 1S/C17H11NO8/c1-24-15-8-4-10(18(22)23)13-9(17(20)21)5-12-16(26-6-25-12)14(13)7(8)2-3-11(15)19/h2-5,19H,6H2,1H3,(H,20,21) |
| InChIKey | UCLGCTLOEZZSLA-UHFFFAOYSA-N |
| SMILES | OC1=CC=C2C(C=C([N+]([O-])=O)C3=C(C(O)=O)C=C(OCO4)C4=C32)=C1OC |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H310-H351-H341-H330-H300 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501-P201-P202-P281-P308+P313-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Carc. 2 Muta. 2 |
