(11R,12R)-9,10-DIHYDRO-9,10-ETHANOANTHRACENE-11,12-DIAMINE
- Product Name(11R,12R)-9,10-DIHYDRO-9,10-ETHANOANTHRACENE-11,12-DIAMINE
- CAS181139-49-1
- CBNumberCB2500731
- MFC16H16N2
- MW236.31
- MDL NumberMFCD09038519
- MOL File181139-49-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 159 °C |
| Boiling point | 396.7±42.0 °C(Predicted) |
| Density | 1.195±0.06 g/cm3(Predicted) |
| refractive index | -18 ° (C=1, H2O) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 9.38±0.40(Predicted) |
| color | White to Orange to Green |
| BRN | 11652813 |
| InChI | 1S/C16H16N2/c17-15-13-9-5-1-2-6-10(9)14(16(15)18)12-8-4-3-7-11(12)13/h1-8,13-16H,17-18H2/t13-,14+,15-,16-/m0/s1 |
| InChIKey | NWDYSRZJOLDMRE-FZKCQIBNSA-N |
| SMILES | N[C@@H]1[C@@H](N)[C@@H]2c3ccccc3[C@H]1c4ccccc24 |
| UNSPSC Code | 12352116 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335-H410 | |||||||||
| Precautionary statements | P261-P264-P271-P273-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,N | |||||||||
| Risk Statements | 36/37/38-50/53 | |||||||||
| Safety Statements | 26-61 | |||||||||
| RIDADR | UN 3077 9 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2921.59.8090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
