181139-49-1
| Name | (11R,12R)-9,10-DIHYDRO-9,10-ETHANOANTHRACENE-11,12-DIAMINE |
| CAS | 181139-49-1 |
| Molecular Formula | C16H16N2 |
| MDL Number | MFCD09038520 |
| Molecular Weight | 236.312 |
| MOL File | 181139-49-1.mol |
Chemical Properties
| Melting point | 159 °C |
| Boiling point | 396.7±42.0 °C(Predicted) |
| density | 1.195±0.06 g/cm3(Predicted) |
| refractive index | -18 ° (C=1, H2O) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 9.38±0.40(Predicted) |
| color | White to Orange to Green |
| BRN | 11652813 |
| InChI | 1S/C16H16N2/c17-15-13-9-5-1-2-6-10(9)14(16(15)18)12-8-4-3-7-11(12)13/h1-8,13-16H,17-18H2/t13-,14+,15-,16-/m0/s1 |
| InChIKey | NWDYSRZJOLDMRE-FZKCQIBNSA-N |
| SMILES | N[C@@H]1[C@@H](N)[C@@H]2c3ccccc3[C@H]1c4ccccc24 |
Safety Data
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2921.59.8090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |