(11S,12S)-9,10-Dihydro-9,10-ethanoanthracene-11,12-diamine
- Product Name(11S,12S)-9,10-Dihydro-9,10-ethanoanthracene-11,12-diamine
- CAS138517-66-5
- CBNumberCB5500732
- MFC16H16N2
- MW236.31
- MDL NumberMFCD09038520
- MOL File138517-66-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 158 °C |
| Boiling point | 396.7±42.0 °C(Predicted) |
| Density | 1.195±0.06 g/cm3(Predicted) |
| refractive index | 20 ° (C=1, MeOH) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 9.38±0.40(Predicted) |
| color | White to Orange to Green |
| optical activity | Consistent with structure |
| BRN | 8693351 |
| InChI | 1S/C16H16N2/c17-15-13-9-5-1-2-6-10(9)14(16(15)18)12-8-4-3-7-11(12)13/h1-8,13-16H,17-18H2/t13-,14+,15-,16-/m1/s1 |
| InChIKey | NWDYSRZJOLDMRE-QKPAOTATSA-N |
| SMILES | N[C@H]1[C@H](N)[C@H]2c3ccccc3[C@@H]1c4ccccc24 |
| UNSPSC Code | 12352116 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2921.51.5000 | |||||||||
| Storage Class | 13 - Non Combustible Solids | |||||||||
| NFPA 704: |
|
