![(-)-2,2'-METHYLENEBIS[(3AS,8AR)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE] Structure](https://www.chemicalbook.com/CAS/GIF/175166-49-1.gif)
(-)-2,2'-METHYLENEBIS[(3AS,8AR)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE]
- Product Name(-)-2,2'-METHYLENEBIS[(3AS,8AR)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE]
- CAS175166-49-1
- CBNumberCB2493114
- MFC21H18N2O2
- MW330.38
- MDL NumberMFCD00799561
- MOL File175166-49-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 224 °C |
| Boiling point | 493.2±45.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| refractive index | -360 ° (C=1, CH2Cl2) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | almost transparency in Dichloromethane |
| form | powder to crystal |
| pka | 5.47±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]22/D 355°, c = 3.7 in chloroform |
| InChI | 1S/C21H18N2O2/c1-3-7-14-12(5-1)9-16-20(14)22-18(24-16)11-19-23-21-15-8-4-2-6-13(15)10-17(21)25-19/h1-8,16-17,20-21H,9-11H2/t16-,17-,20+,21+/m1/s1 |
| InChIKey | BDHSVQLSNIGJNC-JYWFKMLOSA-N |
| SMILES | C1[C@H]2OC(CC3=N[C@@H]4[C@H](Cc5ccccc45)O3)=N[C@@H]2c6ccccc16 |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|