2,4,5-Trichlorobenzenesulfonyl chloride
- Product Name2,4,5-Trichlorobenzenesulfonyl chloride
- CAS15945-07-0
- CBNumberCB2448396
- MFC6H2Cl4O2S
- MW279.96
- EINECS240-079-0
- MDL NumberMFCD00007428
- MOL File15945-07-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 65-69 °C |
| Boiling point | 138 °C(Press: 0.5 Torr) |
| Density | 1.728±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 1112595 |
| InChI | 1S/C6H2Cl4O2S/c7-3-1-5(9)6(2-4(3)8)13(10,11)12/h1-2H |
| InChIKey | WNVVRCKTQSCPAC-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(cc1Cl)S(Cl)(=O)=O |
| CAS DataBase Reference | 15945-07-0(CAS DataBase Reference) |
| FDA UNII | 7GD5283XIX |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,4,5-trichloro- (15945-07-0) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-14 | |||||||||
| Safety Statements | 26-27-36/37/39-8-45 | |||||||||
| RIDADR | 3261 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049095 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
