2,4,6-Trichlorobenzenesulfonyl chloride
- Product Name2,4,6-Trichlorobenzenesulfonyl chloride
- CAS51527-73-2
- CBNumberCB1289552
- MFC6H2Cl4O2S
- MW279.96
- EINECS624-725-2
- MDL NumberMFCD00052973
- MOL File51527-73-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 44-48 °C (lit.) |
| Boiling point | 341.0±42.0 °C(Predicted) |
| Density | 1.728±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Moisture Sensitive |
| BRN | 1534870 |
| InChI | 1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H |
| InChIKey | WHJAQKAAIOHCGN-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 51527-73-2(CAS DataBase Reference) |
| Comptox DTXSID | DTXSID10334621 |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310 | |||||||||
| Hazard Codes | C,F+ | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45-39-37-36 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2904990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
