2,4,6-Trichlorobenzenesulfonyl chloride
- Product Name2,4,6-Trichlorobenzenesulfonyl chloride
- CAS51527-73-2
- MFC6H2Cl4O2S
- MW279.96
- EINECS624-725-2
- MOL File51527-73-2.mol
Chemical Properties
| Melting point | 44-48 °C (lit.) |
| Boiling point | 341.0±42.0 °C(Predicted) |
| Density | 1.728±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Moisture Sensitive |
| BRN | 1534870 |
| InChI | 1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H |
| InChIKey | WHJAQKAAIOHCGN-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 51527-73-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,F+ |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2904990090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |