FUMONISIN B1
- Product NameFUMONISIN B1
- CAS116355-83-0
- CBNumberCB1773259
- MFC34H59NO15
- MW721.83
- EINECS621-436-3
- MDL NumberMFCD00133349
- MOL File116355-83-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >60oC |
| Boiling point | 713.81°C (rough estimate) |
| Density | 1.2207 (rough estimate) |
| refractive index | 1.6630 (estimate) |
| Flash point | 6 °C |
| storage temp. | 2-8°C |
| solubility | Soluble in Water (up to 25 mg/ml). |
| form | Powder |
| pka | 3+-.0.23(Predicted) |
| color | White to tan |
| biological source | Fusarium sp. (Fusarium moniliforme) |
| Stability | Stable for 2 years from date of purchase as supplied. Solutions in distilled water may be stored at -20° for up to 3 months. |
| InChIKey | GPIYLYZFGAXYSU-UHFFFAOYSA-N |
| SMILES | C(CC(C)CC(O)CCCCC(O)CC(O)C(N)C)(OC(=O)CC(C(=O)O)CC(=O)O)C(CC(C)CCC)OC(=O)CC(C(=O)O)CC(=O)O |
| Toxicology and Carcinogenesis | Toxicology and Carcinogenesis Studies of Fumonisin B1 (CASRN 116355-83-0) in F344/N Rats and B6C3F1 Mice (Feed Studies) |
| CAS DataBase Reference | 116355-83-0 |
| FDA UNII | 3ZZM97XZ32 |
| Proposition 65 List | Fumonisin B1 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H301-H351-H361d-H373 |
| Precautionary statements | P201-P301+P310+P330 |
| Hazard Codes | Xn,T,F |
| Risk Statements | 40-36-20/21/22-11 |
| Safety Statements | 36/37-16-26-45 |
| RIDADR | 3172 |
| WGK Germany | 3 |
| RTECS | TZ8350000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Repr. 2 STOT RE 2 |
| Hazardous Substances Data | 116355-83-0(Hazardous Substances Data) |
