3,5-Dimethoxyphenylacetic acid
- Product Name3,5-Dimethoxyphenylacetic acid
- CAS4670-10-4
- CBNumberCB1678154
- MFC10H12O4
- MW196.2
- MDL NumberMFCD00016827
- MOL File4670-10-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 102-103 °C(lit.) |
| Boiling point | 293.08°C (rough estimate) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.08±0.10(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C10H12O4/c1-13-8-3-7(5-10(11)12)4-9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12) |
| InChIKey | FFPAFDDLAGTGPQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(OC)=CC(OC)=C1 |
| CAS DataBase Reference | 4670-10-4(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-36/37 | |||||||||
| Safety Statements | 26-36-36/37 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29189900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
