4-Bromo-3-chlorobenzoic acid
- Product Name4-Bromo-3-chlorobenzoic acid
- CAS25118-59-6
- CBNumberCB1501498
- MFC7H4BrClO2
- MW235.46
- MDL NumberMFCD08276864
- MOL File25118-59-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 220-224 °C |
| Boiling point | 333.7±27.0 °C(Predicted) |
| Density | 1.809±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.60±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4BrClO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | PSKJIHDVFDVNBU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(Cl)=C1 |
| CAS DataBase Reference | 25118-59-6 |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H400 | |||||||||
| Precautionary statements | P273-P301+P310+P330 | |||||||||
| Hazard Codes | Xn,N,Xi | |||||||||
| Risk Statements | 22-50/53 | |||||||||
| Safety Statements | 60-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 | |||||||||
| NFPA 704: |
|
