p-Nitrophenyl phosphate di(Tris) salt
- Product Namep-Nitrophenyl phosphate di(Tris) salt
- CAS68189-42-4
- CBNumberCB1443187
- MFC14H28N3O12P
- MW461.36
- EINECS269-198-6
- MDL NumberMFCD00037009
- MOL File68189-42-4.mol
- MSDS FileSDS
Chemical Properties
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear |
| form | Off-white to pale yellow solid |
| color | White to Orange to Green |
| Water Solubility | water: soluble |
| BRN | 1578142 |
| InChI | 1S/C6H6NO6P.2C4H11NO3/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;2*5-4(1-6,2-7)3-8/h1-4H,(H2,10,11,12);2*6-8H,1-3,5H2 |
| InChIKey | XXAXKCWOTRABOW-UHFFFAOYSA-N |
| SMILES | NC(CO)(CO)CO.NC(CO)(CO)CO.OP(O)(=O)Oc1ccc(cc1)[N+]([O-])=O |
| LogP | -2.16 at 22℃ |
| CAS DataBase Reference | 68189-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | Mono(p-nitrophenyl) phosphate 2-amino-2-(hydroxymethyl)-1,3-propanediol salt (1:2) (68189-42-4) |
| UNSPSC Code | 41116158 |
| NACRES | NA.83 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 8-10-21 |
| TSCA | TSCA listed |
| HS Code | 29199000 |
| Storage Class | 11 - Combustible Solids |
