4,4'-Bis(bromomethyl)biphenyl
- Product Name4,4'-Bis(bromomethyl)biphenyl
- CAS20248-86-6
- CBNumberCB1355226
- MFC14H12Br2
- MW340.05
- MDL NumberMFCD00094419
- MOL File20248-86-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 169.0 to 173.0 °C |
| Boiling point | 399.8±37.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 2444585 |
| InChI | InChI=1S/C14H12Br2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| InChIKey | HMUGRILXVBKBID-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CBr)C=C2)=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 20248-86-6 |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314-H410 | |||||||||
| Precautionary statements | P260-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | C,N | |||||||||
| Risk Statements | 36/37/38-50/53-34-22 | |||||||||
| Safety Statements | 26-36/37/39-61-60-45 | |||||||||
| RIDADR | UN 3261 8 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29039990 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
