4,4'-Bis(bromomethyl)biphenyl
- Product Name4,4'-Bis(bromomethyl)biphenyl
- CAS20248-86-6
- MFC14H12Br2
- MW340.05
- EINECS
- MOL File20248-86-6.mol
Chemical Properties
| Melting point | 169.0 to 173.0 °C |
| Boiling point | 399.8±37.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 2444585 |
| InChI | InChI=1S/C14H12Br2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| InChIKey | HMUGRILXVBKBID-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CBr)C=C2)=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 20248-86-6 |
Safety Information
| Hazard Codes | C,N |
| Risk Statements | 36/37/38-50/53-34-22 |
| Safety Statements | 26-36/37/39-61-60-45 |
| RIDADR | UN 3261 8 / PGIII |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Corr. 1B |