20248-86-6
| Name | 4,4'-BIS(BROMOMETHYL)BIPHENYL |
| CAS | 20248-86-6 |
| Molecular Formula | C14H12Br2 |
| MDL Number | MFCD00094419 |
| Molecular Weight | 340.05 |
| MOL File | 20248-86-6.mol |
Chemical Properties
| Melting point | 169.0 to 173.0 °C |
| Boiling point | 399.8±37.0 °C(Predicted) |
| density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 2444585 |
| InChI | InChI=1S/C14H12Br2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| InChIKey | HMUGRILXVBKBID-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CBr)C=C2)=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 20248-86-6 |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H410 |
| Precautionary statements | P260-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8 / PGIII |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Corr. 1B |