1,3,5-Triacryloylhexahydro-1,3,5-triazine
- Product Name1,3,5-Triacryloylhexahydro-1,3,5-triazine
- CAS959-52-4
- CBNumberCB1240416
- MFC12H15N3O3
- MW249.27
- EINECS213-501-6
- MDL NumberMFCD00035738
- MOL File959-52-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 156 °C (dec.) (lit.) |
| Boiling point | 392.37°C (rough estimate) |
| Density | 1.1998 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | -1.00±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H15N3O3/c1-4-10(16)13-7-14(11(17)5-2)9-15(8-13)12(18)6-3/h4-6H,1-3,7-9H2 |
| InChIKey | FYBFGAFWCBMEDG-UHFFFAOYSA-N |
| SMILES | N1(C(=O)C=C)CN(C(=O)C=C)CN(C(=O)C=C)C1 |
| CAS DataBase Reference | 959-52-4(CAS DataBase Reference) |
| FDA UNII | P69A1S76RB |
| EPA Substance Registry System | 1,3,5-Triazine, hexahydro-1,3,5-tris(1-oxo-2-propenyl)- (959-52-4) |
| UNSPSC Code | 12162002 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H310-H314-H317-H331-H334 | |||||||||
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 23/24/25-34-42/43 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2928 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | XY9260000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.2 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29336990 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 3 Inhalation Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 | |||||||||
| NFPA 704: |
|
