959-52-4
| Name | 1,3,5-Triacryloylhexahydro-1,3,5-triazine |
| CAS | 959-52-4 |
| EINECS(EC#) | 213-501-6 |
| Molecular Formula | C12H15N3O3 |
| MDL Number | MFCD00035738 |
| Molecular Weight | 249.27 |
| MOL File | 959-52-4.mol |
Chemical Properties
| Melting point | 156 °C (dec.) (lit.) |
| Boiling point | 392.37°C (rough estimate) |
| density | 1.1998 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| pka | -1.00±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H15N3O3/c1-4-10(16)13-7-14(11(17)5-2)9-15(8-13)12(18)6-3/h4-6H,1-3,7-9H2 |
| InChIKey | FYBFGAFWCBMEDG-UHFFFAOYSA-N |
| SMILES | N1(C(=O)C=C)CN(C(=O)C=C)CN(C(=O)C=C)C1 |
| CAS DataBase Reference | 959-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | 959-52-4(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H310-H314-H317-H331-H334 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | XY9260000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 4.2 |
| PackingGroup | II |
| HS Code | 29336990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 3 Inhalation Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |