(R)-(+)-2,2'-Dimethoxy-1,1'-binaphthalene
- Product Name(R)-(+)-2,2'-Dimethoxy-1,1'-binaphthalene
- CAS35294-28-1
- CBNumberCB1141050
- MFC22H18O2
- MW314.38
- EINECS233-305-4
- MDL NumberMFCD00091146
- MOL File35294-28-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 227-231 °C(lit.) |
| Boiling point | 414.1±30.0 °C(Predicted) |
| Density | 1.160±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +52°, c = 1% in chloroform |
| BRN | 4704231 |
| InChI | 1S/C22H18O2/c1-23-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)24-2/h3-14H,1-2H3 |
| InChIKey | BJAADAKPADTRCH-UHFFFAOYSA-N |
| SMILES | O(C)c1c(c4c(cc1)cccc4)c2c3c(ccc2OC)cccc3 |
| CAS DataBase Reference | 35294-28-1(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,N | |||||||||
| Risk Statements | 41-50/53-37/38 | |||||||||
| Safety Statements | 26-36/39-60-61-36 | |||||||||
| RIDADR | UN 3077 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2909.30.6000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Dam. 1 | |||||||||
| NFPA 704: |
|
