(Triisopropylsilyl)acetylene
- Product Name(Triisopropylsilyl)acetylene
- CAS89343-06-6
- CBNumberCB0416001
- MFC11H22Si
- MW182.38
- EINECS629-580-9
- MDL NumberMFCD00075452
- MOL File89343-06-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 50-51 °C |
| Boiling point | 50-52 °C/0.6 mmHg (lit.) |
| Density | 0.813 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 133 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with organic solvents. |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 0.813 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3536241 |
| InChI | InChI=1S/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3 |
| InChIKey | KZGWPHUWNWRTEP-UHFFFAOYSA-N |
| SMILES | [Si](C#C)(C(C)C)(C(C)C)C(C)C |
| CAS DataBase Reference | 89343-06-6(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-37/39 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | N | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
