
89343-06-6
| Name | (TRIISOPROPYLSILYL)ACETYLENE |
| CAS | 89343-06-6 |
| EINECS(EC#) | 629-580-9 |
| Molecular Formula | C11H22Si |
| MDL Number | MFCD00075452 |
| Molecular Weight | 182.38 |
| MOL File | 89343-06-6.mol |
Chemical Properties
| Appearance | clear colorless liquid |
| Melting point | 50-51 °C |
| Boiling point | 50-52 °C/0.6 mmHg (lit.) |
| density | 0.813 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 133 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Miscible with organic solvents. |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 0.813 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3536241 |
| InChI | InChI=1S/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3 |
| InChIKey | KZGWPHUWNWRTEP-UHFFFAOYSA-N |
| SMILES | [Si](C#C)(C(C)C)(C(C)C)C(C)C |
| CAS DataBase Reference | 89343-06-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | N |
| REACH Registrations | Active |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

