5-Norbornene-2-carbonitrile
- Product Name5-Norbornene-2-carbonitrile
- CAS95-11-4
- CBNumberCB0153050
- MFC8H9N
- MW119.16
- EINECS202-391-5
- MDL NumberMFCD00167563
- MOL File95-11-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 12-14 °C(lit.) |
| Boiling point | 82-86 °C10 mm Hg(lit.) |
| Density | 0.999 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 150 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C8H9N/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-4H2 |
| InChIKey | BMAXQTDMWYDIJX-UHFFFAOYSA-N |
| SMILES | C12CC(C=C1)CC2C#N |
| CAS DataBase Reference | 95-11-4(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| NIST Chemistry Reference | Bicyclo[2.2.1]hept-5-ene-2-carbonitrile(95-11-4) |
| EPA Substance Registry System | Bicyclo[2.2.1]hept-5-ene-2-carbonitrile (95-11-4) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-36/37 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | RB7930000 | |||||||||
| HS Code | 29269090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| Toxicity | LD50 ivn-mus: 10 mg/kg CSLNX* NX#00780 | |||||||||
| NFPA 704: |
|
