BETA-BUTYROLACTONE
- Product NameBETA-BUTYROLACTONE
- CAS3068-88-0
- CBNumberCB0111872
- MFC4H6O2
- MW86.09
- EINECS221-330-3
- MDL NumberMFCD00005170
- MOL File3068-88-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | −43.5 °C(lit.) |
| Boiling point | 71-73 °C29 mm Hg(lit.) |
| Density | 1.056 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 140 °F |
| storage temp. | Storage temp. 2-8°C |
| color | Colorless to Almost colorless |
| Water Solubility | 132.7g/L(18 ºC) |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. Flammable. |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | InChI=1S/C4H6O2/c1-3-2-4(5)6-3/h3H,2H2,1H3 |
| InChIKey | GSCLMSFRWBPUSK-UHFFFAOYSA-N |
| SMILES | O1C(C)CC1=O |
| CAS DataBase Reference | 3068-88-0(CAS DataBase Reference) |
| EWG's Food Scores | 2 |
| FDA UNII | 8BB68V31MT |
| Proposition 65 List | beta-Butyrolactone |
| IARC | 2B (Vol. 11, Sup 7, 71) 1999 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H351 | |||||||||
| Precautionary statements | P201-P210-P302+P352-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/38-40 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | RQ8050000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2932.20.5050 | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 | |||||||||
| NFPA 704: |
|
