Polyvinylpyrrolidone K 90
- Product NamePolyvinylpyrrolidone K 90
- CAS9003-39-8
- CBNumberCB00124099
- MFCH4
- MW16.04246
- EINECS1312995-182-4
- MDL NumberMFCD01076626
- MOL File9003-39-8.mol
Chemical Properties
| Melting point | >300 °C |
| Boiling point | 90-93 °C |
| Density | 1,69 g/cm3 |
| Tg | 175 |
| refractive index | (25) 1.5300 |
| refractive index | 1.5300 |
| storage temp. | 2-8°C |
| solubility | H2O: soluble100mg/mL |
| form | powder |
| color | White to yellow-white |
| PH | 3.0-5.0 |
| Viscosity | 0.06(Intrinsic viscosity) |
| Viscosity | 1.61(Intrinsic viscosity) |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,7697 |
| Stability | Stable. Incompatible with strong oxidizing agents. Light sensitive. Hygroscopic. |
| InChI | InChI=1S/C8H15NO/c1-3-7(2)9-6-4-5-8(9)10/h7H,3-6H2,1-2H3 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H360D | |||||||||
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | TR8370000 | |||||||||
| Autoignition Temperature | 440 °C | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 39059990 | |||||||||
| Hazardous Substances Data | 9003-39-8(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg | |||||||||
| NFPA 704: |
|
