
99-18-3
| Name | PRUNASIN |
| CAS | 99-18-3 |
| EINECS(EC#) | 202-738-0 |
| Molecular Formula | C14H17NO6 |
| MDL Number | MFCD00049232 |
| Molecular Weight | 295.29 |
| MOL File | 99-18-3.mol |
Chemical Properties
| Melting point | 138-148°C |
| Boiling point | 527.0±50.0 °C(Predicted) |
| density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 12.71±0.70(Predicted) |
| color | White to off-white |
| Stability: | Hygroscopic |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2/t9-,10+,11+,12-,13+,14+/s3 |
| InChIKey | ZKSZEJFBGODIJW-OAWZEMCWNA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)[C@H](C1C=CC=CC=1)C#N |&1:1,2,3,5,7,12,r| |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| RTECS | UL3420000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 1B |