71963-77-4
| Name | Artemether |
| CAS | 71963-77-4 |
| EINECS(EC#) | 663-549-0 |
| Molecular Formula | C16H26O5 |
| MDL Number | MFCD00866205 |
| Molecular Weight | 298.37 |
| MOL File | 71963-77-4.mol |
Chemical Properties
| Melting point | 86-88°C |
| alpha | D19.5 +171° (c = 2.59 in CHCl3) |
| Boiling point | 359.79°C (rough estimate) |
| density | 1.0733 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | room temp |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| color | off-white to light brown |
| Optical Rotation | [α]/D +155 to +175°, c = 0.5 in methanol |
| Merck | 14,815 |
| InChI | InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |
| InChIKey | SXYIRMFQILZOAM-HVNFFKDJSA-N |
| SMILES | O1[C@]23[C@@]4([H])O[C@@](C)(CC[C@@]2([H])[C@H](C)CC[C@@]3([H])[C@@H](C)[C@@H](OC)O4)O1 |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H242-H302 |
| Precautionary statements | P210-P235-P280-P301+P312-P370+P378-P410 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | KD4165000 |
| HS Code | 29329930 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Org. Perox. D |
| Hazardous Substances Data | 71963-77-4(Hazardous Substances Data) |
| Toxicity |