97-51-8
| Name | 5-Nitrosalicylaldehyde |
| CAS | 97-51-8 |
| EINECS(EC#) | 202-587-0 |
| Molecular Formula | C7H5NO4 |
| MDL Number | MFCD00007337 |
| Molecular Weight | 167.12 |
| MOL File | 97-51-8.mol |
Chemical Properties
| Appearance | yellow to brown crystals or powder |
| Melting point | 125-128 °C(lit.) |
| Boiling point | 295.67°C (rough estimate) |
| density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Water (Slightly) |
| form | Powder or Crystals |
| pka | 5.08±0.22(Predicted) |
| color | Yellow to orange to brown |
| Water Solubility | Soluble in water (partly). |
| Sensitive | Air & Light Sensitive |
| BRN | 512565 |
| InChI | 1S/C7H5NO4/c9-4-5-3-6(8(11)12)1-2-7(5)10/h1-4,10H |
| InChIKey | IHFRMUGEILMHNU-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc(ccc1O)[N+]([O-])=O |
| CAS DataBase Reference | 97-51-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Nitrosalicylaldehyde(97-51-8) |
| EPA Substance Registry System | 97-51-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CU6675000 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |